tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate

C12H13N3O2 — CID 175394711

IUPACtert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate
SMILESCC(C)(C)OC(=O)N1CC(=CC#N)C1=CC#N
InChIInChI=1S/C12H13N3O2/c1-12(2,3)17-11(16)15-8-9(4-6-13)10(15)5-7-14/h4-5H,8H2,1-3H3
InChIKeyLKWXEUDUCIXBFK-UHFFFAOYSA-N
MW231.25 g/mol
LogP2.09
Rot. Bonds

About tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate

tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate (PubChem CID 175394711) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate.

Molecular Properties

Compound Nametert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate
PubChem CID175394711
Molecular FormulaC12H13N3O2
Molecular Weight231.25 g/mol
Exact Mass231.10
IUPAC Nametert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate
SMILESCC(C)(C)OC(=O)N1CC(=CC#N)C1=CC#N
InChIInChI=1S/C12H13N3O2/c1-12(2,3)17-11(16)15-8-9(4-6-13)10(15)5-7-14/h4-5H,8H2,1-3H3
InChIKeyLKWXEUDUCIXBFK-UHFFFAOYSA-N
XLogP2.09
TPSA77.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}

Analyze tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate?
The IUPAC name of tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate (CID 175394711) is tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate?
The canonical SMILES for tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate is CC(C)(C)OC(=O)N1CC(=CC#N)C1=CC#N.
What is the InChIKey of tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate?
The InChIKey is LKWXEUDUCIXBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-12(2,3)17-11(16)15-8-9(4-6-13)10(15)5-7-14/h4-5H,8H2,1-3H3.
What are the key properties of tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate?
tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate has a molecular weight of 231.25 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,3-bis(cyanomethylidene)azetidine-1-carboxylate is sourced from PubChem (CID 175394711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).