C31H27F3N4O4 — CID 175395203
(2,2,2-trifluoroacetyl) (6S)-1-[(4-amino-3-methylphenyl)methyl]-5-(2,2-diphenylacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 175395203) has the molecular formula C31H27F3N4O4 and a molecular weight of 576.58 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (6S)-1-[(4-amino-3-methylphenyl)methyl]-5-(2,2-diphenylacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (6S)-1-[(4-amino-3-methylphenyl)methyl]-5-(2,2-diphenylacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 175395203 |
| Molecular Formula | C31H27F3N4O4 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (6S)-1-[(4-amino-3-methylphenyl)methyl]-5-(2,2-diphenylacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | Cc1cc(Cn2cnc3c2C[C@@H](C(=O)OC(=O)C(F)(F)F)N(C(=O)C(c2ccccc2)c2ccccc2)C3)ccc1N |
| InChI | InChI=1S/C31H27F3N4O4/c1-19-14-20(12-13-23(19)35)16-37-18-36-24-17-38(26(15-25(24)37)29(40)42-30(41)31(32,33)34)28(39)27(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-14,18,26-27H,15-17,35H2,1H3/t26-/m0/s1 |
| InChIKey | BXABIJDGZDUFBL-SANMLTNESA-N |
| XLogP | 4.54 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|