methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate

C14H14N2O2 — CID 175395313

IUPACmethyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate
SMILESCOC(=O)c1cc(C#N)c(C(C)C)c(C#N)c1C
InChIInChI=1S/C14H14N2O2/c1-8(2)13-10(6-15)5-11(14(17)18-4)9(3)12(13)7-16/h5,8H,1-4H3
InChIKeyUVWPIOFNCPHAQJ-UHFFFAOYSA-N
MW242.28 g/mol
LogP2.65
Rot. Bonds2

About methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate

methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate (PubChem CID 175395313) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate.

Molecular Properties

Compound Namemethyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate
PubChem CID175395313
Molecular FormulaC14H14N2O2
Molecular Weight242.28 g/mol
Exact Mass242.11
IUPAC Namemethyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate
SMILESCOC(=O)c1cc(C#N)c(C(C)C)c(C#N)c1C
InChIInChI=1S/C14H14N2O2/c1-8(2)13-10(6-15)5-11(14(17)18-4)9(3)12(13)7-16/h5,8H,1-4H3
InChIKeyUVWPIOFNCPHAQJ-UHFFFAOYSA-N
XLogP2.65
TPSA73.88 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.28
LogP ≤ 52.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate?
The IUPAC name of methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate (CID 175395313) is methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate.
What is the SMILES notation for methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate?
The canonical SMILES for methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate is COC(=O)c1cc(C#N)c(C(C)C)c(C#N)c1C.
What is the InChIKey of methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate?
The InChIKey is UVWPIOFNCPHAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2/c1-8(2)13-10(6-15)5-11(14(17)18-4)9(3)12(13)7-16/h5,8H,1-4H3.
What are the key properties of methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate?
methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate has a molecular weight of 242.28 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dicyano-2-methyl-4-propan-2-ylbenzoate is sourced from PubChem (CID 175395313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).