C9H14F3NO — CID 175395381
N-cyclopropyl-4,4,4-trifluoro-N,3-dimethylbutanamide (PubChem CID 175395381) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is N-cyclopropyl-4,4,4-trifluoro-N,3-dimethylbutanamide.
| Compound Name | N-cyclopropyl-4,4,4-trifluoro-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 175395381 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-cyclopropyl-4,4,4-trifluoro-N,3-dimethylbutanamide |
| SMILES | CC(CC(=O)N(C)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO/c1-6(9(10,11)12)5-8(14)13(2)7-3-4-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZHPGMOXTHMHWAM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |