C13H13ClF3N3O3 — CID 175396220
[(2R)-1-(6-chloro-3-fluoropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl carbamate (PubChem CID 175396220) has the molecular formula C13H13ClF3N3O3 and a molecular weight of 351.71 g/mol. Its IUPAC name is [(2R)-1-(6-chloro-3-fluoropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl carbamate.
| Compound Name | [(2R)-1-(6-chloro-3-fluoropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 175396220 |
| Molecular Formula | C13H13ClF3N3O3 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [(2R)-1-(6-chloro-3-fluoropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@H]1CCC(F)(F)CN1C(=O)c1nc(Cl)ccc1F |
| InChI | InChI=1S/C13H13ClF3N3O3/c14-9-2-1-8(15)10(19-9)11(21)20-6-13(16,17)4-3-7(20)5-23-12(18)22/h1-2,7H,3-6H2,(H2,18,22)/t7-/m1/s1 |
| InChIKey | KIEMDWUJPSDVGE-SSDOTTSWSA-N |
| XLogP | 2.21 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|