C16H30O2 — CID 175396356
acetic acid;(8Z)-tetradeca-1,8-diene (PubChem CID 175396356) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is acetic acid;(8Z)-tetradeca-1,8-diene.
| Compound Name | acetic acid;(8Z)-tetradeca-1,8-diene |
|---|---|
| PubChem CID | 175396356 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | acetic acid;(8Z)-tetradeca-1,8-diene |
| SMILES | C=CCCCCC/C=C\CCCCC.CC(=O)O |
| InChI | InChI=1S/C14H26.C2H4O2/c1-3-5-7-9-11-13-14-12-10-8-6-4-2;1-2(3)4/h3,12,14H,1,4-11,13H2,2H3;1H3,(H,3,4)/b14-12-; |
| InChIKey | QOXASUNQVVSPHE-CTMPBGLUSA-N |
| XLogP | 5.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|