About N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione
N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione (PubChem CID 175397001) has the molecular formula C12H25N5O3
and a molecular weight of 287.36 g/mol. Its IUPAC name is N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione.
Molecular Properties
| Compound Name | N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione |
| PubChem CID | 175397001 |
| Molecular Formula | C12H25N5O3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione |
| SMILES | NCCNCCNCCNCCN.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C8H23N5.C4H2O3/c9-1-3-11-5-7-13-8-6-12-4-2-10;5-3-1-2-4(6)7-3/h11-13H,1-10H2;1-2H |
| InChIKey | AXFKJGZTNHHVCQ-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione?
The IUPAC name of N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione (CID 175397001) is N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione.
What is the SMILES notation for N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione?
The canonical SMILES for N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione is NCCNCCNCCNCCN.O=C1C=CC(=O)O1.
What is the InChIKey of N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione?
The InChIKey is AXFKJGZTNHHVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H23N5.C4H2O3/c9-1-3-11-5-7-13-8-6-12-4-2-10;5-3-1-2-4(6)7-3/h11-13H,1-10H2;1-2H.
What are the key properties of N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione?
N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione has a molecular weight of 287.36 g/mol, XLogP of -2.70, 10 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;furan-2,5-dione is sourced from PubChem (CID 175397001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).