About N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide
N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 175397304) has the molecular formula C15H23F2N3O
and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide |
| PubChem CID | 175397304 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | Cc1nn(C(C)C)c(C(=O)NC2CCC(F)(F)CC2)c1C |
| InChI | InChI=1S/C15H23F2N3O/c1-9(2)20-13(10(3)11(4)19-20)14(21)18-12-5-7-15(16,17)8-6-12/h9,12H,5-8H2,1-4H3,(H,18,21) |
| InChIKey | RRZDYURMIWRSDK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide?
The IUPAC name of N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide (CID 175397304) is N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide is Cc1nn(C(C)C)c(C(=O)NC2CCC(F)(F)CC2)c1C.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide?
The InChIKey is RRZDYURMIWRSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2N3O/c1-9(2)20-13(10(3)11(4)19-20)14(21)18-12-5-7-15(16,17)8-6-12/h9,12H,5-8H2,1-4H3,(H,18,21).
What are the key properties of N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide?
N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide has a molecular weight of 299.37 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-4,5-dimethyl-2-propan-2-ylpyrazole-3-carboxamide is sourced from PubChem (CID 175397304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).