C11H19F3N2OS — CID 175397420
tert-butyl-[[(1S)-1-cyano-2,4,4-trifluoro-3,3-dimethylbutyl]amino]-oxidosulfanium (PubChem CID 175397420) has the molecular formula C11H19F3N2OS and a molecular weight of 284.35 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1-cyano-2,4,4-trifluoro-3,3-dimethylbutyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1-cyano-2,4,4-trifluoro-3,3-dimethylbutyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175397420 |
| Molecular Formula | C11H19F3N2OS |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | tert-butyl-[[(1S)-1-cyano-2,4,4-trifluoro-3,3-dimethylbutyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C(F)F)C(F)[C@H](C#N)N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C11H19F3N2OS/c1-10(2,3)18(17)16-7(6-15)8(12)11(4,5)9(13)14/h7-9,16H,1-5H3/t7-,8?,18?/m0/s1 |
| InChIKey | VXGRWZKVZNBANA-QEHHLIOKSA-N |
| XLogP | 2.56 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|