C13H24O3 — CID 175398409
2-tert-butylperoxy-2,3,3-trimethylcyclohexan-1-one (PubChem CID 175398409) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-tert-butylperoxy-2,3,3-trimethylcyclohexan-1-one.
| Compound Name | 2-tert-butylperoxy-2,3,3-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 175398409 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-tert-butylperoxy-2,3,3-trimethylcyclohexan-1-one |
| SMILES | CC(C)(C)OOC1(C)C(=O)CCCC1(C)C |
| InChI | InChI=1S/C13H24O3/c1-11(2,3)15-16-13(6)10(14)8-7-9-12(13,4)5/h7-9H2,1-6H3 |
| InChIKey | WVINGUYHBAUXEN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|