C32H32N2O9 — CID 175398986
3-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropyl]-8-methylquinazolin-4-one (PubChem CID 175398986) has the molecular formula C32H32N2O9 and a molecular weight of 588.61 g/mol. Its IUPAC name is 3-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropyl]-8-methylquinazolin-4-one.
| Compound Name | 3-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropyl]-8-methylquinazolin-4-one |
|---|---|
| PubChem CID | 175398986 |
| Molecular Formula | C32H32N2O9 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 3-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropyl]-8-methylquinazolin-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCn3cnc4c(C)cccc4c3=O)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C32H32N2O9/c1-18-9-7-10-21-27(18)33-17-34(32(21)36)11-8-12-42-31-28(35)26-22(38-3)15-20(37-2)16-23(26)43-29(31)19-13-24(39-4)30(41-6)25(14-19)40-5/h7,9-10,13-17H,8,11-12H2,1-6H3 |
| InChIKey | VNHHPAHMCVQNOS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 120.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|