C32H31ClN2O9 — CID 175398991
7-chloro-3-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl]quinazolin-4-one (PubChem CID 175398991) has the molecular formula C32H31ClN2O9 and a molecular weight of 623.06 g/mol. Its IUPAC name is 7-chloro-3-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl]quinazolin-4-one |
|---|---|
| PubChem CID | 175398991 |
| Molecular Formula | C32H31ClN2O9 |
| Molecular Weight | 623.06 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 7-chloro-3-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl]quinazolin-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCn3cnc4cc(Cl)ccc4c3=O)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C32H31ClN2O9/c1-38-20-15-23(39-2)27-24(16-20)44-29(18-12-25(40-3)30(42-5)26(13-18)41-4)31(28(27)36)43-11-7-6-10-35-17-34-22-14-19(33)8-9-21(22)32(35)37/h8-9,12-17H,6-7,10-11H2,1-5H3 |
| InChIKey | YKCLRKIUMLKFEF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 120.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.06 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|