About 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid
2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid (PubChem CID 175399768) has the molecular formula C22H23F3O3
and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid.
Molecular Properties
| Compound Name | 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid |
| PubChem CID | 175399768 |
| Molecular Formula | C22H23F3O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)c1c(F)cc(-c2cccc(F)c2)c(OC2CCC2)c1F |
| InChI | InChI=1S/C22H23F3O3/c1-2-3-10-16(22(26)27)19-18(24)12-17(13-6-4-7-14(23)11-13)21(20(19)25)28-15-8-5-9-15/h4,6-7,11-12,15-16H,2-3,5,8-10H2,1H3,(H,26,27) |
| InChIKey | JUHJOIGWPQLXHG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid?
The IUPAC name of 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid (CID 175399768) is 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid.
What is the SMILES notation for 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid?
The canonical SMILES for 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid is CCCCC(C(=O)O)c1c(F)cc(-c2cccc(F)c2)c(OC2CCC2)c1F.
What is the InChIKey of 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid?
The InChIKey is JUHJOIGWPQLXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F3O3/c1-2-3-10-16(22(26)27)19-18(24)12-17(13-6-4-7-14(23)11-13)21(20(19)25)28-15-8-5-9-15/h4,6-7,11-12,15-16H,2-3,5,8-10H2,1H3,(H,26,27).
What are the key properties of 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid?
2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid has a molecular weight of 392.42 g/mol, XLogP of 6.06, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-cyclobutyloxy-2,6-difluoro-4-(3-fluorophenyl)phenyl]hexanoic acid is sourced from PubChem (CID 175399768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).