About [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate
[(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate (PubChem CID 175399932) has the molecular formula C11H11F2NO3S
and a molecular weight of 275.28 g/mol. Its IUPAC name is [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate.
Molecular Properties
| Compound Name | [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate |
| PubChem CID | 175399932 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](CCC#N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2NO3S/c1-18(15,16)17-11(3-2-6-14)8-4-5-9(12)10(13)7-8/h4-5,7,11H,2-3H2,1H3/t11-/m1/s1 |
| InChIKey | WOZGMXZSXWWLDA-LLVKDONJSA-N |
| XLogP | 2.29 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate?
The IUPAC name of [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate (CID 175399932) is [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate.
What is the SMILES notation for [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate?
The canonical SMILES for [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate is CS(=O)(=O)O[C@H](CCC#N)c1ccc(F)c(F)c1.
What is the InChIKey of [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate?
The InChIKey is WOZGMXZSXWWLDA-LLVKDONJSA-N. The full InChI is InChI=1S/C11H11F2NO3S/c1-18(15,16)17-11(3-2-6-14)8-4-5-9(12)10(13)7-8/h4-5,7,11H,2-3H2,1H3/t11-/m1/s1.
What are the key properties of [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate?
[(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate has a molecular weight of 275.28 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-3-cyano-1-(3,4-difluorophenyl)propyl] methanesulfonate is sourced from PubChem (CID 175399932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).