About tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate
tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate (PubChem CID 175400019) has the molecular formula C31H27N5O2
and a molecular weight of 501.59 g/mol. Its IUPAC name is tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate.
Molecular Properties
| Compound Name | tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate |
| PubChem CID | 175400019 |
| Molecular Formula | C31H27N5O2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(C2=Cc3cc4ccc(cc5nc(cc6ccc(cc2n3)[nH]6)C=C5)[nH]4)c(N)c1 |
| InChI | InChI=1S/C31H27N5O2/c1-31(2,3)38-30(37)18-4-11-26(28(32)12-18)27-16-25-15-23-8-7-21(34-23)13-19-5-6-20(33-19)14-22-9-10-24(35-22)17-29(27)36-25/h4-17,34-35H,32H2,1-3H3/b19-13-,20-14-,21-13-,22-14-,23-15-,24-17-,25-15-,29-17- |
| InChIKey | PQPUNGCGUOQUBQ-OAENUGHSSA-N |
| XLogP | 6.61 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate?
The IUPAC name of tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate (CID 175400019) is tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate.
What is the SMILES notation for tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate?
The canonical SMILES for tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate is CC(C)(C)OC(=O)c1ccc(C2=Cc3cc4ccc(cc5nc(cc6ccc(cc2n3)[nH]6)C=C5)[nH]4)c(N)c1.
What is the InChIKey of tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate?
The InChIKey is PQPUNGCGUOQUBQ-OAENUGHSSA-N. The full InChI is InChI=1S/C31H27N5O2/c1-31(2,3)38-30(37)18-4-11-26(28(32)12-18)27-16-25-15-23-8-7-21(34-23)13-19-5-6-20(33-19)14-22-9-10-24(35-22)17-29(27)36-25/h4-17,34-35H,32H2,1-3H3/b19-13-,20-14-,21-13-,22-14-,23-15-,24-17-,25-15-,29-17-.
What are the key properties of tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate?
tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate has a molecular weight of 501.59 g/mol, XLogP of 6.61, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-amino-4-(22,24-dihydroporphyrin-2-yl)benzoate is sourced from PubChem (CID 175400019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).