About tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide
tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide (PubChem CID 175400185) has the molecular formula C11H20ClN2Nb-2
and a molecular weight of 308.65 g/mol. Its IUPAC name is tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide.
Molecular Properties
| Compound Name | tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide |
| PubChem CID | 175400185 |
| Molecular Formula | C11H20ClN2Nb-2 |
| Molecular Weight | 308.65 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide |
| SMILES | CC(C)(C)/N=[Nb]/Cl.C[N-]C.[C-]1=CC=CC1 |
| InChI | InChI=1S/C5H5.C4H9N.C2H6N.ClH.Nb/c1-2-4-5-3-1;1-4(2,3)5;1-3-2;;/h1-3H,4H2;1-3H3;1-2H3;1H;/q-1;;-1;;+1/p-1 |
| InChIKey | JBIQRJOXZWRSLX-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide?
The IUPAC name of tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide (CID 175400185) is tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide.
What is the SMILES notation for tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide?
The canonical SMILES for tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide is CC(C)(C)/N=[Nb]/Cl.C[N-]C.[C-]1=CC=CC1.
What is the InChIKey of tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide?
The InChIKey is JBIQRJOXZWRSLX-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5.C4H9N.C2H6N.ClH.Nb/c1-2-4-5-3-1;1-4(2,3)5;1-3-2;;/h1-3H,4H2;1-3H3;1-2H3;1H;/q-1;;-1;;+1/p-1.
What are the key properties of tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide?
tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide has a molecular weight of 308.65 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylimino(chloro)niobium;cyclopenta-1,3-diene;dimethylazanide is sourced from PubChem (CID 175400185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).