About azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid
azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid (PubChem CID 175400265) has the molecular formula C7H15NO7S
and a molecular weight of 257.26 g/mol. Its IUPAC name is azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid.
Molecular Properties
| Compound Name | azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid |
| PubChem CID | 175400265 |
| Molecular Formula | C7H15NO7S |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid |
| SMILES | CCCS(=O)(=O)O.N.O=C1COCC(=O)O1 |
| InChI | InChI=1S/C4H4O4.C3H8O3S.H3N/c5-3-1-7-2-4(6)8-3;1-2-3-7(4,5)6;/h1-2H2;2-3H2,1H3,(H,4,5,6);1H3 |
| InChIKey | RRWPDDJDEDLSJS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid?
The IUPAC name of azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid (CID 175400265) is azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid.
What is the SMILES notation for azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid?
The canonical SMILES for azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid is CCCS(=O)(=O)O.N.O=C1COCC(=O)O1.
What is the InChIKey of azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid?
The InChIKey is RRWPDDJDEDLSJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O4.C3H8O3S.H3N/c5-3-1-7-2-4(6)8-3;1-2-3-7(4,5)6;/h1-2H2;2-3H2,1H3,(H,4,5,6);1H3.
What are the key properties of azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid?
azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid has a molecular weight of 257.26 g/mol, XLogP of -0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,4-dioxane-2,6-dione;propane-1-sulfonic acid is sourced from PubChem (CID 175400265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).