About bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate
bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate (PubChem CID 175400751) has the molecular formula C23H42N4O3
and a molecular weight of 422.61 g/mol. Its IUPAC name is bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate.
Molecular Properties
| Compound Name | bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate |
| PubChem CID | 175400751 |
| Molecular Formula | C23H42N4O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate |
| SMILES | CCC(C)CC(CC)[n+]1cc[nH]c1.CCC(C)CC(CC)[n+]1cc[nH]c1.O=C([O-])[O-] |
| InChI | InChI=1S/2C11H20N2.CH2O3/c2*1-4-10(3)8-11(5-2)13-7-6-12-9-13;2-1(3)4/h2*6-7,9-11H,4-5,8H2,1-3H3;(H2,2,3,4) |
| InChIKey | FKOZMNSKVZLNBT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate?
The IUPAC name of bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate (CID 175400751) is bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate.
What is the SMILES notation for bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate?
The canonical SMILES for bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate is CCC(C)CC(CC)[n+]1cc[nH]c1.CCC(C)CC(CC)[n+]1cc[nH]c1.O=C([O-])[O-].
What is the InChIKey of bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate?
The InChIKey is FKOZMNSKVZLNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H20N2.CH2O3/c2*1-4-10(3)8-11(5-2)13-7-6-12-9-13;2-1(3)4/h2*6-7,9-11H,4-5,8H2,1-3H3;(H2,2,3,4).
What are the key properties of bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate?
bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate has a molecular weight of 422.61 g/mol, XLogP of 2.93, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-(5-methylheptan-3-yl)-1H-imidazol-3-ium);carbonate is sourced from PubChem (CID 175400751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).