About potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate
potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate (PubChem CID 175401551) has the molecular formula C20H33KO3
and a molecular weight of 360.58 g/mol. Its IUPAC name is potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate.
Molecular Properties
| Compound Name | potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate |
| PubChem CID | 175401551 |
| Molecular Formula | C20H33KO3 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate |
| SMILES | CCCCCCCCCCC(OC1(C)C=CC=CC1C)C(=O)[O-].[K+] |
| InChI | InChI=1S/C20H34O3.K/c1-4-5-6-7-8-9-10-11-15-18(19(21)22)23-20(3)16-13-12-14-17(20)2;/h12-14,16-18H,4-11,15H2,1-3H3,(H,21,22);/q;+1/p-1 |
| InChIKey | ZWBXBWBXGMSUQU-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate?
The IUPAC name of potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate (CID 175401551) is potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate.
What is the SMILES notation for potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate?
The canonical SMILES for potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate is CCCCCCCCCCC(OC1(C)C=CC=CC1C)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate?
The InChIKey is ZWBXBWBXGMSUQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H34O3.K/c1-4-5-6-7-8-9-10-11-15-18(19(21)22)23-20(3)16-13-12-14-17(20)2;/h12-14,16-18H,4-11,15H2,1-3H3,(H,21,22);/q;+1/p-1.
What are the key properties of potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate?
potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate has a molecular weight of 360.58 g/mol, XLogP of 1.18, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxydodecanoate is sourced from PubChem (CID 175401551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).