About acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene
acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 175402052) has the molecular formula C8H5Cl
and a molecular weight of 136.58 g/mol. Its IUPAC name is acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene.
Molecular Properties
| Compound Name | acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene |
| PubChem CID | 175402052 |
| Molecular Formula | C8H5Cl |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | C#C.Clc1cc2ccc1-2 |
| InChI | InChI=1S/C6H3Cl.C2H2/c7-6-3-4-1-2-5(4)6;1-2/h1-3H;1-2H |
| InChIKey | FLMRHXVCEIKSJG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene?
The IUPAC name of acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene (CID 175402052) is acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene.
What is the SMILES notation for acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene?
The canonical SMILES for acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene is C#C.Clc1cc2ccc1-2.
What is the InChIKey of acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene?
The InChIKey is FLMRHXVCEIKSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl.C2H2/c7-6-3-4-1-2-5(4)6;1-2/h1-3H;1-2H.
What are the key properties of acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene?
acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene has a molecular weight of 136.58 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-chlorobicyclo[2.2.0]hexa-1,3,5-triene is sourced from PubChem (CID 175402052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).