C9H12N4O3 — CID 175402081
4-butyl-3,9-dihydropurine-2,6,8-trione (PubChem CID 175402081) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-butyl-3,9-dihydropurine-2,6,8-trione.
| Compound Name | 4-butyl-3,9-dihydropurine-2,6,8-trione |
|---|---|
| PubChem CID | 175402081 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-butyl-3,9-dihydropurine-2,6,8-trione |
| SMILES | CCCCC12NC(=O)N=C1C(=O)NC(=O)N2 |
| InChI | InChI=1S/C9H12N4O3/c1-2-3-4-9-5(10-7(15)12-9)6(14)11-8(16)13-9/h2-4H2,1H3,(H,12,15)(H2,11,13,14,16) |
| InChIKey | PQYIFGVGNPNFTQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |