C23H17Cl2N3O — CID 175402521
3,5-dibenzyl-1-(3,4-dichlorophenyl)-1,2,4-triazin-6-one (PubChem CID 175402521) has the molecular formula C23H17Cl2N3O and a molecular weight of 422.32 g/mol. Its IUPAC name is 3,5-dibenzyl-1-(3,4-dichlorophenyl)-1,2,4-triazin-6-one.
| Compound Name | 3,5-dibenzyl-1-(3,4-dichlorophenyl)-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 175402521 |
| Molecular Formula | C23H17Cl2N3O |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3,5-dibenzyl-1-(3,4-dichlorophenyl)-1,2,4-triazin-6-one |
| SMILES | O=c1c(Cc2ccccc2)nc(Cc2ccccc2)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3O/c24-19-12-11-18(15-20(19)25)28-23(29)21(13-16-7-3-1-4-8-16)26-22(27-28)14-17-9-5-2-6-10-17/h1-12,15H,13-14H2 |
| InChIKey | XEXHOSYTDGBYSV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |