C8H7F7 — CID 175402785
3,3,4,4,5,5-hexafluoro-1-(2-fluoropropan-2-yl)cyclopentene (PubChem CID 175402785) has the molecular formula C8H7F7 and a molecular weight of 236.13 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(2-fluoropropan-2-yl)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(2-fluoropropan-2-yl)cyclopentene |
|---|---|
| PubChem CID | 175402785 |
| Molecular Formula | C8H7F7 |
| Molecular Weight | 236.13 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(2-fluoropropan-2-yl)cyclopentene |
| SMILES | CC(C)(F)C1=CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H7F7/c1-5(2,9)4-3-6(10,11)8(14,15)7(4,12)13/h3H,1-2H3 |
| InChIKey | MOGDBCDXPLNJJZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.13 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|