About formonitrile;2,3,4,5-tetrachloropyridine
formonitrile;2,3,4,5-tetrachloropyridine (PubChem CID 175403027) has the molecular formula C6H2Cl4N2
and a molecular weight of 243.91 g/mol. Its IUPAC name is formonitrile;2,3,4,5-tetrachloropyridine.
Molecular Properties
| Compound Name | formonitrile;2,3,4,5-tetrachloropyridine |
| PubChem CID | 175403027 |
| Molecular Formula | C6H2Cl4N2 |
| Molecular Weight | 243.91 g/mol |
| Exact Mass | 241.90 |
| IUPAC Name | formonitrile;2,3,4,5-tetrachloropyridine |
| SMILES | C#N.Clc1cnc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C5HCl4N.CHN/c6-2-1-10-5(9)4(8)3(2)7;1-2/h1H;1H |
| InChIKey | CUICHDUWEJINAA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze formonitrile;2,3,4,5-tetrachloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;2,3,4,5-tetrachloropyridine?
The IUPAC name of formonitrile;2,3,4,5-tetrachloropyridine (CID 175403027) is formonitrile;2,3,4,5-tetrachloropyridine.
What is the SMILES notation for formonitrile;2,3,4,5-tetrachloropyridine?
The canonical SMILES for formonitrile;2,3,4,5-tetrachloropyridine is C#N.Clc1cnc(Cl)c(Cl)c1Cl.
What is the InChIKey of formonitrile;2,3,4,5-tetrachloropyridine?
The InChIKey is CUICHDUWEJINAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HCl4N.CHN/c6-2-1-10-5(9)4(8)3(2)7;1-2/h1H;1H.
What are the key properties of formonitrile;2,3,4,5-tetrachloropyridine?
formonitrile;2,3,4,5-tetrachloropyridine has a molecular weight of 243.91 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;2,3,4,5-tetrachloropyridine is sourced from PubChem (CID 175403027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).