About 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide
4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide (PubChem CID 175403452) has the molecular formula C17H21BrClO2PS
and a molecular weight of 435.75 g/mol. Its IUPAC name is 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide.
Molecular Properties
| Compound Name | 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide |
| PubChem CID | 175403452 |
| Molecular Formula | C17H21BrClO2PS |
| Molecular Weight | 435.75 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide |
| SMILES | Br.CCc1cccc(PCc2ccc(S(=O)(=O)Cl)cc2)c1CC |
| InChI | InChI=1S/C17H20ClO2PS.BrH/c1-3-14-6-5-7-17(16(14)4-2)21-12-13-8-10-15(11-9-13)22(18,19)20;/h5-11,21H,3-4,12H2,1-2H3;1H |
| InChIKey | ILWXNEWTVSNFSU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide?
The IUPAC name of 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide (CID 175403452) is 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide.
What is the SMILES notation for 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide?
The canonical SMILES for 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide is Br.CCc1cccc(PCc2ccc(S(=O)(=O)Cl)cc2)c1CC.
What is the InChIKey of 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide?
The InChIKey is ILWXNEWTVSNFSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClO2PS.BrH/c1-3-14-6-5-7-17(16(14)4-2)21-12-13-8-10-15(11-9-13)22(18,19)20;/h5-11,21H,3-4,12H2,1-2H3;1H.
What are the key properties of 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide?
4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide has a molecular weight of 435.75 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,3-diethylphenyl)phosphanylmethyl]benzenesulfonyl chloride;hydrobromide is sourced from PubChem (CID 175403452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).