C19H18F6 — CID 175404262
1-[2-(3,4-dimethylphenyl)propan-2-yl]-2,3,6-trifluoro-5-methyl-4-(trifluoromethyl)benzene (PubChem CID 175404262) has the molecular formula C19H18F6 and a molecular weight of 360.34 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenyl)propan-2-yl]-2,3,6-trifluoro-5-methyl-4-(trifluoromethyl)benzene.
| Compound Name | 1-[2-(3,4-dimethylphenyl)propan-2-yl]-2,3,6-trifluoro-5-methyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 175404262 |
| Molecular Formula | C19H18F6 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[2-(3,4-dimethylphenyl)propan-2-yl]-2,3,6-trifluoro-5-methyl-4-(trifluoromethyl)benzene |
| SMILES | Cc1ccc(C(C)(C)c2c(F)c(C)c(C(F)(F)F)c(F)c2F)cc1C |
| InChI | InChI=1S/C19H18F6/c1-9-6-7-12(8-10(9)2)18(4,5)14-15(20)11(3)13(19(23,24)25)16(21)17(14)22/h6-8H,1-5H3 |
| InChIKey | HTHYVBIKZFDQLK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|