About 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene
4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 175404491) has the molecular formula C9H10S2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene.
Molecular Properties
| Compound Name | 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene |
| PubChem CID | 175404491 |
| Molecular Formula | C9H10S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | C=CCC12C=CC3SC3C1S2 |
| InChI | InChI=1S/C9H10S2/c1-2-4-9-5-3-6-7(10-6)8(9)11-9/h2-3,5-8H,1,4H2 |
| InChIKey | GJXSHKQRGMIMKE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
The IUPAC name of 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene (CID 175404491) is 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene.
What is the SMILES notation for 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
The canonical SMILES for 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene is C=CCC12C=CC3SC3C1S2.
What is the InChIKey of 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
The InChIKey is GJXSHKQRGMIMKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S2/c1-2-4-9-5-3-6-7(10-6)8(9)11-9/h2-3,5-8H,1,4H2.
What are the key properties of 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene has a molecular weight of 182.31 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene is sourced from PubChem (CID 175404491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).