C9H28O2Si4 — CID 175404731
2,2,3,3,6,6-hexamethyloxadisilinane;silyloxysilane (PubChem CID 175404731) has the molecular formula C9H28O2Si4 and a molecular weight of 280.66 g/mol. Its IUPAC name is 2,2,3,3,6,6-hexamethyloxadisilinane;silyloxysilane.
| Compound Name | 2,2,3,3,6,6-hexamethyloxadisilinane;silyloxysilane |
|---|---|
| PubChem CID | 175404731 |
| Molecular Formula | C9H28O2Si4 |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2,2,3,3,6,6-hexamethyloxadisilinane;silyloxysilane |
| SMILES | CC1(C)CC[Si](C)(C)[Si](C)(C)O1.[SiH3]O[SiH3] |
| InChI | InChI=1S/C9H22OSi2.H6OSi2/c1-9(2)7-8-11(3,4)12(5,6)10-9;2-1-3/h7-8H2,1-6H3;2-3H3 |
| InChIKey | QAZXWQVXRFTUHF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|