About ethenyl 1,2,2-trichloroethyl carbonate
ethenyl 1,2,2-trichloroethyl carbonate (PubChem CID 175405013) has the molecular formula C5H5Cl3O3
and a molecular weight of 219.45 g/mol. Its IUPAC name is ethenyl 1,2,2-trichloroethyl carbonate.
Molecular Properties
| Compound Name | ethenyl 1,2,2-trichloroethyl carbonate |
| PubChem CID | 175405013 |
| Molecular Formula | C5H5Cl3O3 |
| Molecular Weight | 219.45 g/mol |
| Exact Mass | 217.93 |
| IUPAC Name | ethenyl 1,2,2-trichloroethyl carbonate |
| SMILES | C=COC(=O)OC(Cl)C(Cl)Cl |
| InChI | InChI=1S/C5H5Cl3O3/c1-2-10-5(9)11-4(8)3(6)7/h2-4H,1H2 |
| InChIKey | RDDUEQUSPZXPTQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 1,2,2-trichloroethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 1,2,2-trichloroethyl carbonate?
The IUPAC name of ethenyl 1,2,2-trichloroethyl carbonate (CID 175405013) is ethenyl 1,2,2-trichloroethyl carbonate.
What is the SMILES notation for ethenyl 1,2,2-trichloroethyl carbonate?
The canonical SMILES for ethenyl 1,2,2-trichloroethyl carbonate is C=COC(=O)OC(Cl)C(Cl)Cl.
What is the InChIKey of ethenyl 1,2,2-trichloroethyl carbonate?
The InChIKey is RDDUEQUSPZXPTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl3O3/c1-2-10-5(9)11-4(8)3(6)7/h2-4H,1H2.
What are the key properties of ethenyl 1,2,2-trichloroethyl carbonate?
ethenyl 1,2,2-trichloroethyl carbonate has a molecular weight of 219.45 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 1,2,2-trichloroethyl carbonate is sourced from PubChem (CID 175405013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).