C7H6F3N — CID 175405303
3-(1,2,2-trifluoroethyl)pyridine (PubChem CID 175405303) has the molecular formula C7H6F3N and a molecular weight of 161.13 g/mol. Its IUPAC name is 3-(1,2,2-trifluoroethyl)pyridine.
| Compound Name | 3-(1,2,2-trifluoroethyl)pyridine |
|---|---|
| PubChem CID | 175405303 |
| Molecular Formula | C7H6F3N |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 3-(1,2,2-trifluoroethyl)pyridine |
| SMILES | FC(F)C(F)c1cccnc1 |
| InChI | InChI=1S/C7H6F3N/c8-6(7(9)10)5-2-1-3-11-4-5/h1-4,6-7H |
| InChIKey | VCTOWHCYIPIFSP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |