(2R)-2,5-dimethylpiperazine-1-carboxylic acid

C7H14N2O2 — CID 175405538

IUPAC(2R)-2,5-dimethylpiperazine-1-carboxylic acid
SMILESCC1CN(C(=O)O)[C@H](C)CN1
InChIInChI=1S/C7H14N2O2/c1-5-4-9(7(10)11)6(2)3-8-5/h5-6,8H,3-4H2,1-2H3,(H,10,11)/t5?,6-/m1/s1
InChIKeyMVWFPRWHZFBWSY-PRJDIBJQSA-N
MW158.20 g/mol
LogP0.35
Rot. Bonds

About (2R)-2,5-dimethylpiperazine-1-carboxylic acid

(2R)-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 175405538) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (2R)-2,5-dimethylpiperazine-1-carboxylic acid.

Molecular Properties

Compound Name(2R)-2,5-dimethylpiperazine-1-carboxylic acid
PubChem CID175405538
Molecular FormulaC7H14N2O2
Molecular Weight158.20 g/mol
Exact Mass158.11
IUPAC Name(2R)-2,5-dimethylpiperazine-1-carboxylic acid
SMILESCC1CN(C(=O)O)[C@H](C)CN1
InChIInChI=1S/C7H14N2O2/c1-5-4-9(7(10)11)6(2)3-8-5/h5-6,8H,3-4H2,1-2H3,(H,10,11)/t5?,6-/m1/s1
InChIKeyMVWFPRWHZFBWSY-PRJDIBJQSA-N
XLogP0.35
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 50.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-2,5-dimethylpiperazine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2,5-dimethylpiperazine-1-carboxylic acid?
The IUPAC name of (2R)-2,5-dimethylpiperazine-1-carboxylic acid (CID 175405538) is (2R)-2,5-dimethylpiperazine-1-carboxylic acid.
What is the SMILES notation for (2R)-2,5-dimethylpiperazine-1-carboxylic acid?
The canonical SMILES for (2R)-2,5-dimethylpiperazine-1-carboxylic acid is CC1CN(C(=O)O)[C@H](C)CN1.
What is the InChIKey of (2R)-2,5-dimethylpiperazine-1-carboxylic acid?
The InChIKey is MVWFPRWHZFBWSY-PRJDIBJQSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-5-4-9(7(10)11)6(2)3-8-5/h5-6,8H,3-4H2,1-2H3,(H,10,11)/t5?,6-/m1/s1.
What are the key properties of (2R)-2,5-dimethylpiperazine-1-carboxylic acid?
(2R)-2,5-dimethylpiperazine-1-carboxylic acid has a molecular weight of 158.20 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,5-dimethylpiperazine-1-carboxylic acid is sourced from PubChem (CID 175405538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).