About lithium;tritert-butylalumane;hydroxide
lithium;tritert-butylalumane;hydroxide (PubChem CID 175406578) has the molecular formula C12H28AlLiO
and a molecular weight of 222.28 g/mol. Its IUPAC name is lithium;tritert-butylalumane;hydroxide.
Molecular Properties
| Compound Name | lithium;tritert-butylalumane;hydroxide |
| PubChem CID | 175406578 |
| Molecular Formula | C12H28AlLiO |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | lithium;tritert-butylalumane;hydroxide |
| SMILES | CC(C)(C)[Al](C(C)(C)C)C(C)(C)C.[Li+].[OH-] |
| InChI | InChI=1S/3C4H9.Al.Li.H2O/c3*1-4(2)3;;;/h3*1-3H3;;;1H2/q;;;;+1;/p-1 |
| InChIKey | DQGGFVSSJKERMU-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;tritert-butylalumane;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;tritert-butylalumane;hydroxide?
The IUPAC name of lithium;tritert-butylalumane;hydroxide (CID 175406578) is lithium;tritert-butylalumane;hydroxide.
What is the SMILES notation for lithium;tritert-butylalumane;hydroxide?
The canonical SMILES for lithium;tritert-butylalumane;hydroxide is CC(C)(C)[Al](C(C)(C)C)C(C)(C)C.[Li+].[OH-].
What is the InChIKey of lithium;tritert-butylalumane;hydroxide?
The InChIKey is DQGGFVSSJKERMU-UHFFFAOYSA-M. The full InChI is InChI=1S/3C4H9.Al.Li.H2O/c3*1-4(2)3;;;/h3*1-3H3;;;1H2/q;;;;+1;/p-1.
What are the key properties of lithium;tritert-butylalumane;hydroxide?
lithium;tritert-butylalumane;hydroxide has a molecular weight of 222.28 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;tritert-butylalumane;hydroxide is sourced from PubChem (CID 175406578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).