About 1-bromopropane-1,2-diamine;hydrobromide
1-bromopropane-1,2-diamine;hydrobromide (PubChem CID 175406855) has the molecular formula C3H10Br2N2
and a molecular weight of 233.94 g/mol. Its IUPAC name is 1-bromopropane-1,2-diamine;hydrobromide.
Molecular Properties
| Compound Name | 1-bromopropane-1,2-diamine;hydrobromide |
| PubChem CID | 175406855 |
| Molecular Formula | C3H10Br2N2 |
| Molecular Weight | 233.94 g/mol |
| Exact Mass | 231.92 |
| IUPAC Name | 1-bromopropane-1,2-diamine;hydrobromide |
| SMILES | Br.CC(N)C(N)Br |
| InChI | InChI=1S/C3H9BrN2.BrH/c1-2(5)3(4)6;/h2-3H,5-6H2,1H3;1H |
| InChIKey | MQVQIIAKXBPCOE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.94 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropane-1,2-diamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropane-1,2-diamine;hydrobromide?
The IUPAC name of 1-bromopropane-1,2-diamine;hydrobromide (CID 175406855) is 1-bromopropane-1,2-diamine;hydrobromide.
What is the SMILES notation for 1-bromopropane-1,2-diamine;hydrobromide?
The canonical SMILES for 1-bromopropane-1,2-diamine;hydrobromide is Br.CC(N)C(N)Br.
What is the InChIKey of 1-bromopropane-1,2-diamine;hydrobromide?
The InChIKey is MQVQIIAKXBPCOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9BrN2.BrH/c1-2(5)3(4)6;/h2-3H,5-6H2,1H3;1H.
What are the key properties of 1-bromopropane-1,2-diamine;hydrobromide?
1-bromopropane-1,2-diamine;hydrobromide has a molecular weight of 233.94 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropane-1,2-diamine;hydrobromide is sourced from PubChem (CID 175406855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).