About 2,3-dinitropyridine;hydrazine
2,3-dinitropyridine;hydrazine (PubChem CID 175406944) has the molecular formula C5H7N5O4
and a molecular weight of 201.14 g/mol. Its IUPAC name is 2,3-dinitropyridine;hydrazine.
Molecular Properties
| Compound Name | 2,3-dinitropyridine;hydrazine |
| PubChem CID | 175406944 |
| Molecular Formula | C5H7N5O4 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2,3-dinitropyridine;hydrazine |
| SMILES | NN.O=[N+]([O-])c1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H3N3O4.H4N2/c9-7(10)4-2-1-3-6-5(4)8(11)12;1-2/h1-3H;1-2H2 |
| InChIKey | ZEUXOTYKWZKFFG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 151.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dinitropyridine;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dinitropyridine;hydrazine?
The IUPAC name of 2,3-dinitropyridine;hydrazine (CID 175406944) is 2,3-dinitropyridine;hydrazine.
What is the SMILES notation for 2,3-dinitropyridine;hydrazine?
The canonical SMILES for 2,3-dinitropyridine;hydrazine is NN.O=[N+]([O-])c1cccnc1[N+](=O)[O-].
What is the InChIKey of 2,3-dinitropyridine;hydrazine?
The InChIKey is ZEUXOTYKWZKFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3O4.H4N2/c9-7(10)4-2-1-3-6-5(4)8(11)12;1-2/h1-3H;1-2H2.
What are the key properties of 2,3-dinitropyridine;hydrazine?
2,3-dinitropyridine;hydrazine has a molecular weight of 201.14 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dinitropyridine;hydrazine is sourced from PubChem (CID 175406944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).