C12H13ClF4N2S2 — CID 175407408
1-(2-chloroethyl)-3-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfanyl)phenyl]thiourea (PubChem CID 175407408) has the molecular formula C12H13ClF4N2S2 and a molecular weight of 360.83 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfanyl)phenyl]thiourea.
| Compound Name | 1-(2-chloroethyl)-3-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 175407408 |
| Molecular Formula | C12H13ClF4N2S2 |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 1-(2-chloroethyl)-3-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfanyl)phenyl]thiourea |
| SMILES | Cc1cc(F)c(NC(=S)NCCCl)cc1SC(F)C(F)F |
| InChI | InChI=1S/C12H13ClF4N2S2/c1-6-4-7(14)8(19-12(20)18-3-2-13)5-9(6)21-11(17)10(15)16/h4-5,10-11H,2-3H2,1H3,(H2,18,19,20) |
| InChIKey | KVDPNJONSMJYJS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|