About 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline
2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline (PubChem CID 175407446) has the molecular formula C8H7ClF3NS
and a molecular weight of 241.67 g/mol. Its IUPAC name is 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline.
Molecular Properties
| Compound Name | 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline |
| PubChem CID | 175407446 |
| Molecular Formula | C8H7ClF3NS |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline |
| SMILES | Nc1cc(SC(F)C(F)F)ccc1Cl |
| InChI | InChI=1S/C8H7ClF3NS/c9-5-2-1-4(3-6(5)13)14-8(12)7(10)11/h1-3,7-8H,13H2 |
| InChIKey | QJLUNCHTILELBU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline?
The IUPAC name of 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline (CID 175407446) is 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline.
What is the SMILES notation for 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline?
The canonical SMILES for 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline is Nc1cc(SC(F)C(F)F)ccc1Cl.
What is the InChIKey of 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline?
The InChIKey is QJLUNCHTILELBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF3NS/c9-5-2-1-4(3-6(5)13)14-8(12)7(10)11/h1-3,7-8H,13H2.
What are the key properties of 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline?
2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline has a molecular weight of 241.67 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(1,2,2-trifluoroethylsulfanyl)aniline is sourced from PubChem (CID 175407446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).