C15F21NO3Si — CID 175407515
(3,4,5,6,7,8-hexafluoroquinolin-2-yl)-tris(1,1,2,2,2-pentafluoroethoxy)silane (PubChem CID 175407515) has the molecular formula C15F21NO3Si and a molecular weight of 669.21 g/mol. Its IUPAC name is (3,4,5,6,7,8-hexafluoroquinolin-2-yl)-tris(1,1,2,2,2-pentafluoroethoxy)silane.
| Compound Name | (3,4,5,6,7,8-hexafluoroquinolin-2-yl)-tris(1,1,2,2,2-pentafluoroethoxy)silane |
|---|---|
| PubChem CID | 175407515 |
| Molecular Formula | C15F21NO3Si |
| Molecular Weight | 669.21 g/mol |
| Exact Mass | 668.93 |
| IUPAC Name | (3,4,5,6,7,8-hexafluoroquinolin-2-yl)-tris(1,1,2,2,2-pentafluoroethoxy)silane |
| SMILES | Fc1c(F)c(F)c2c(F)c(F)c([Si](OC(F)(F)C(F)(F)F)(OC(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)F)nc2c1F |
| InChI | InChI=1S/C15F21NO3Si/c16-2-1-3(17)7(21)9(37-8(1)6(20)5(19)4(2)18)41(38-13(31,32)10(22,23)24,39-14(33,34)11(25,26)27)40-15(35,36)12(28,29)30 |
| InChIKey | JJZWYNPKBFKLOW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.21 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|