C28H25ClF4N4O5S — CID 175407649
[4-[(dimethylamino)methyl]benzoyl] 5-fluoro-2-methyl-3-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]indole-1-carboperoxoate;hydrochloride (PubChem CID 175407649) has the molecular formula C28H25ClF4N4O5S and a molecular weight of 641.04 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]benzoyl] 5-fluoro-2-methyl-3-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]indole-1-carboperoxoate;hydrochloride.
| Compound Name | [4-[(dimethylamino)methyl]benzoyl] 5-fluoro-2-methyl-3-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]indole-1-carboperoxoate;hydrochloride |
|---|---|
| PubChem CID | 175407649 |
| Molecular Formula | C28H25ClF4N4O5S |
| Molecular Weight | 641.04 g/mol |
| Exact Mass | 640.12 |
| IUPAC Name | [4-[(dimethylamino)methyl]benzoyl] 5-fluoro-2-methyl-3-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]indole-1-carboperoxoate;hydrochloride |
| SMILES | Cc1c(NC(=O)Nc2ccc(SC(F)(F)F)cc2)c2cc(F)ccc2n1C(=O)OOC(=O)c1ccc(CN(C)C)cc1.Cl |
| InChI | InChI=1S/C28H24F4N4O5S.ClH/c1-16-24(34-26(38)33-20-9-11-21(12-10-20)42-28(30,31)32)22-14-19(29)8-13-23(22)36(16)27(39)41-40-25(37)18-6-4-17(5-7-18)15-35(2)3;/h4-14H,15H2,1-3H3,(H2,33,34,38);1H |
| InChIKey | ZKZFJKFDIQTDLZ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.04 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|