C14H18FN3O — CID 175408508
(E)-2-(1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indol-7-yloxymethyl)-3-fluoroprop-2-en-1-amine (PubChem CID 175408508) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is (E)-2-(1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indol-7-yloxymethyl)-3-fluoroprop-2-en-1-amine.
| Compound Name | (E)-2-(1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indol-7-yloxymethyl)-3-fluoroprop-2-en-1-amine |
|---|---|
| PubChem CID | 175408508 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (E)-2-(1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indol-7-yloxymethyl)-3-fluoroprop-2-en-1-amine |
| SMILES | NC/C(=C\F)COc1ccc2c(c1)C1CNCC1N2 |
| InChI | InChI=1S/C14H18FN3O/c15-4-9(5-16)8-19-10-1-2-13-11(3-10)12-6-17-7-14(12)18-13/h1-4,12,14,17-18H,5-8,16H2/b9-4+ |
| InChIKey | SCXHPAYTZQDHRA-RUDMXATFSA-N |
| XLogP | 1.36 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|