C21H30F2O2 — CID 175408899
6-ethoxy-1,6-difluoro-2-[[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]cyclohexa-1,3-diene (PubChem CID 175408899) has the molecular formula C21H30F2O2 and a molecular weight of 352.47 g/mol. Its IUPAC name is 6-ethoxy-1,6-difluoro-2-[[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]cyclohexa-1,3-diene.
| Compound Name | 6-ethoxy-1,6-difluoro-2-[[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175408899 |
| Molecular Formula | C21H30F2O2 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 6-ethoxy-1,6-difluoro-2-[[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]cyclohexa-1,3-diene |
| SMILES | CCOC1(F)CC=CC(OCC2CC=C(CCC=C(C)C)CC2)=C1F |
| InChI | InChI=1S/C21H30F2O2/c1-4-25-21(23)14-6-9-19(20(21)22)24-15-18-12-10-17(11-13-18)8-5-7-16(2)3/h6-7,9-10,18H,4-5,8,11-15H2,1-3H3 |
| InChIKey | DNEHLDDWAASGDY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|