C20H28F2O2 — CID 175408902
1,5-difluoro-2-[(4-hex-4-en-2-ylcyclohex-3-en-1-yl)methoxy]-5-methoxycyclohexa-1,3-diene (PubChem CID 175408902) has the molecular formula C20H28F2O2 and a molecular weight of 338.44 g/mol. Its IUPAC name is 1,5-difluoro-2-[(4-hex-4-en-2-ylcyclohex-3-en-1-yl)methoxy]-5-methoxycyclohexa-1,3-diene.
| Compound Name | 1,5-difluoro-2-[(4-hex-4-en-2-ylcyclohex-3-en-1-yl)methoxy]-5-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175408902 |
| Molecular Formula | C20H28F2O2 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1,5-difluoro-2-[(4-hex-4-en-2-ylcyclohex-3-en-1-yl)methoxy]-5-methoxycyclohexa-1,3-diene |
| SMILES | CC=CCC(C)C1=CCC(COC2=C(F)CC(F)(OC)C=C2)CC1 |
| InChI | InChI=1S/C20H28F2O2/c1-4-5-6-15(2)17-9-7-16(8-10-17)14-24-19-11-12-20(22,23-3)13-18(19)21/h4-5,9,11-12,15-16H,6-8,10,13-14H2,1-3H3 |
| InChIKey | BTQFRWZTIWDOHN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|