C18H20N4O2 — CID 175409928
N-(2,3,3a,4-tetrahydro-1H-indole-2-carbonylimino)-2,3,3a,4-tetrahydro-1H-indole-2-carboxamide (PubChem CID 175409928) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(2,3,3a,4-tetrahydro-1H-indole-2-carbonylimino)-2,3,3a,4-tetrahydro-1H-indole-2-carboxamide.
| Compound Name | N-(2,3,3a,4-tetrahydro-1H-indole-2-carbonylimino)-2,3,3a,4-tetrahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175409928 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-(2,3,3a,4-tetrahydro-1H-indole-2-carbonylimino)-2,3,3a,4-tetrahydro-1H-indole-2-carboxamide |
| SMILES | O=C(/N=N/C(=O)C1CC2CC=CC=C2N1)C1CC2CC=CC=C2N1 |
| InChI | InChI=1S/C18H20N4O2/c23-17(15-9-11-5-1-3-7-13(11)19-15)21-22-18(24)16-10-12-6-2-4-8-14(12)20-16/h1-4,7-8,11-12,15-16,19-20H,5-6,9-10H2/b22-21+ |
| InChIKey | REOMVHNJMQAVLH-QURGRASLSA-N |
| XLogP | 2.14 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|