About 3-pentyl-2-thiophen-2-ylthiophene;phenazine
3-pentyl-2-thiophen-2-ylthiophene;phenazine (PubChem CID 175409994) has the molecular formula C25H24N2S2
and a molecular weight of 416.62 g/mol. Its IUPAC name is 3-pentyl-2-thiophen-2-ylthiophene;phenazine.
Molecular Properties
| Compound Name | 3-pentyl-2-thiophen-2-ylthiophene;phenazine |
| PubChem CID | 175409994 |
| Molecular Formula | C25H24N2S2 |
| Molecular Weight | 416.62 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-pentyl-2-thiophen-2-ylthiophene;phenazine |
| SMILES | CCCCCc1ccsc1-c1cccs1.c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C13H16S2.C12H8N2/c1-2-3-4-6-11-8-10-15-13(11)12-7-5-9-14-12;1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h5,7-10H,2-4,6H2,1H3;1-8H |
| InChIKey | MSSXVVOWXWTSKV-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.62 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-2-thiophen-2-ylthiophene;phenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-2-thiophen-2-ylthiophene;phenazine?
The IUPAC name of 3-pentyl-2-thiophen-2-ylthiophene;phenazine (CID 175409994) is 3-pentyl-2-thiophen-2-ylthiophene;phenazine.
What is the SMILES notation for 3-pentyl-2-thiophen-2-ylthiophene;phenazine?
The canonical SMILES for 3-pentyl-2-thiophen-2-ylthiophene;phenazine is CCCCCc1ccsc1-c1cccs1.c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of 3-pentyl-2-thiophen-2-ylthiophene;phenazine?
The InChIKey is MSSXVVOWXWTSKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16S2.C12H8N2/c1-2-3-4-6-11-8-10-15-13(11)12-7-5-9-14-12;1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h5,7-10H,2-4,6H2,1H3;1-8H.
What are the key properties of 3-pentyl-2-thiophen-2-ylthiophene;phenazine?
3-pentyl-2-thiophen-2-ylthiophene;phenazine has a molecular weight of 416.62 g/mol, XLogP of 7.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-2-thiophen-2-ylthiophene;phenazine is sourced from PubChem (CID 175409994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).