C11H26N2 — CID 175410275
2,2,6,6-tetramethylheptane-3,4-diamine (PubChem CID 175410275) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is 2,2,6,6-tetramethylheptane-3,4-diamine.
| Compound Name | 2,2,6,6-tetramethylheptane-3,4-diamine |
|---|---|
| PubChem CID | 175410275 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | 2,2,6,6-tetramethylheptane-3,4-diamine |
| SMILES | CC(C)(C)CC(N)C(N)C(C)(C)C |
| InChI | InChI=1S/C11H26N2/c1-10(2,3)7-8(12)9(13)11(4,5)6/h8-9H,7,12-13H2,1-6H3 |
| InChIKey | QCRDJBDKDKSLKG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |