About 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene
10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene (PubChem CID 175410418) has the molecular formula C32H33N3O2
and a molecular weight of 491.64 g/mol. Its IUPAC name is 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene.
Molecular Properties
| Compound Name | 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene |
| PubChem CID | 175410418 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene |
| SMILES | CC1=C2CC(CC1)C2(C)C.c1ccc(Oc2cccnn2)cc1.c1ccc2c(c1)Nc1ccccc1O2 |
| InChI | InChI=1S/C12H9NO.C10H8N2O.C10H16/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-5-9(6-3-1)13-10-7-4-8-11-12-10;1-7-4-5-8-6-9(7)10(8,2)3/h1-8,13H;1-8H;8H,4-6H2,1-3H3 |
| InChIKey | NQRUZTGTWNSIRN-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
The IUPAC name of 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene (CID 175410418) is 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene.
What is the SMILES notation for 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
The canonical SMILES for 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene is CC1=C2CC(CC1)C2(C)C.c1ccc(Oc2cccnn2)cc1.c1ccc2c(c1)Nc1ccccc1O2.
What is the InChIKey of 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
The InChIKey is NQRUZTGTWNSIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO.C10H8N2O.C10H16/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-5-9(6-3-1)13-10-7-4-8-11-12-10;1-7-4-5-8-6-9(7)10(8,2)3/h1-8,13H;1-8H;8H,4-6H2,1-3H3.
What are the key properties of 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene has a molecular weight of 491.64 g/mol, XLogP of 8.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenoxazine;3-phenoxypyridazine;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene is sourced from PubChem (CID 175410418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).