About dibromolead;6-methyl-1H-benzimidazole
dibromolead;6-methyl-1H-benzimidazole (PubChem CID 175410470) has the molecular formula C8H8Br2N2Pb
and a molecular weight of 499.17 g/mol. Its IUPAC name is dibromolead;6-methyl-1H-benzimidazole.
Molecular Properties
| Compound Name | dibromolead;6-methyl-1H-benzimidazole |
| PubChem CID | 175410470 |
| Molecular Formula | C8H8Br2N2Pb |
| Molecular Weight | 499.17 g/mol |
| Exact Mass | 497.88 |
| IUPAC Name | dibromolead;6-methyl-1H-benzimidazole |
| SMILES | Br[Pb]Br.Cc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C8H8N2.2BrH.Pb/c1-6-2-3-7-8(4-6)10-5-9-7;;;/h2-5H,1H3,(H,9,10);2*1H;/q;;;+2/p-2 |
| InChIKey | NDQJXZNZWSVEKS-UHFFFAOYSA-L |
| XLogP | 3.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibromolead;6-methyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromolead;6-methyl-1H-benzimidazole?
The IUPAC name of dibromolead;6-methyl-1H-benzimidazole (CID 175410470) is dibromolead;6-methyl-1H-benzimidazole.
What is the SMILES notation for dibromolead;6-methyl-1H-benzimidazole?
The canonical SMILES for dibromolead;6-methyl-1H-benzimidazole is Br[Pb]Br.Cc1ccc2nc[nH]c2c1.
What is the InChIKey of dibromolead;6-methyl-1H-benzimidazole?
The InChIKey is NDQJXZNZWSVEKS-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H8N2.2BrH.Pb/c1-6-2-3-7-8(4-6)10-5-9-7;;;/h2-5H,1H3,(H,9,10);2*1H;/q;;;+2/p-2.
What are the key properties of dibromolead;6-methyl-1H-benzimidazole?
dibromolead;6-methyl-1H-benzimidazole has a molecular weight of 499.17 g/mol, XLogP of 3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibromolead;6-methyl-1H-benzimidazole is sourced from PubChem (CID 175410470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).