About 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane
2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane (PubChem CID 175411262) has the molecular formula C9H13Br4NOPb
and a molecular weight of 678.02 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane |
| PubChem CID | 175411262 |
| Molecular Formula | C9H13Br4NOPb |
| Molecular Weight | 678.02 g/mol |
| Exact Mass | 674.75 |
| IUPAC Name | 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane |
| SMILES | Br[Pb](Br)(Br)Br.COc1cccc(CCN)c1 |
| InChI | InChI=1S/C9H13NO.4BrH.Pb/c1-11-9-4-2-3-8(7-9)5-6-10;;;;;/h2-4,7H,5-6,10H2,1H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | XNAMRGFLPYLOQB-UHFFFAOYSA-J |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 678.02 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane?
The IUPAC name of 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane (CID 175411262) is 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane.
What is the SMILES notation for 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane?
The canonical SMILES for 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane is Br[Pb](Br)(Br)Br.COc1cccc(CCN)c1.
What is the InChIKey of 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane?
The InChIKey is XNAMRGFLPYLOQB-UHFFFAOYSA-J. The full InChI is InChI=1S/C9H13NO.4BrH.Pb/c1-11-9-4-2-3-8(7-9)5-6-10;;;;;/h2-4,7H,5-6,10H2,1H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane?
2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane has a molecular weight of 678.02 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)ethanamine;tetrabromoplumbane is sourced from PubChem (CID 175411262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).