About azido-λ2-plumbane;copper(1+);azide
azido-λ2-plumbane;copper(1+);azide (PubChem CID 175411334) has the molecular formula HCuN6Pb
and a molecular weight of 355.80 g/mol. Its IUPAC name is azido-λ2-plumbane;copper(1+);azide.
Molecular Properties
| Compound Name | azido-λ2-plumbane;copper(1+);azide |
| PubChem CID | 175411334 |
| Molecular Formula | HCuN6Pb |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | azido-λ2-plumbane;copper(1+);azide |
| SMILES | [Cu+].[N-]=[N+]=N[PbH].[N-]=[N+]=[N-] |
| InChI | InChI=1S/Cu.2N3.Pb.H/c;2*1-3-2;;/q+1;2*-1;+1; |
| InChIKey | WWLUAHJNAJWIOV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azido-λ2-plumbane;copper(1+);azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido-λ2-plumbane;copper(1+);azide?
The IUPAC name of azido-λ2-plumbane;copper(1+);azide (CID 175411334) is azido-λ2-plumbane;copper(1+);azide.
What is the SMILES notation for azido-λ2-plumbane;copper(1+);azide?
The canonical SMILES for azido-λ2-plumbane;copper(1+);azide is [Cu+].[N-]=[N+]=N[PbH].[N-]=[N+]=[N-].
What is the InChIKey of azido-λ2-plumbane;copper(1+);azide?
The InChIKey is WWLUAHJNAJWIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/Cu.2N3.Pb.H/c;2*1-3-2;;/q+1;2*-1;+1;.
What are the key properties of azido-λ2-plumbane;copper(1+);azide?
azido-λ2-plumbane;copper(1+);azide has a molecular weight of 355.80 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azido-λ2-plumbane;copper(1+);azide is sourced from PubChem (CID 175411334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).