About copper;diazidolead
copper;diazidolead (PubChem CID 175411369) has the molecular formula CuN6Pb
and a molecular weight of 354.79 g/mol. Its IUPAC name is copper;diazidolead.
Molecular Properties
| Compound Name | copper;diazidolead |
|---|
| PubChem CID | 175411369 |
|---|
| Molecular Formula | CuN6Pb |
|---|
| Molecular Weight | 354.79 g/mol |
|---|
| Exact Mass | 354.92 |
|---|
| IUPAC Name | copper;diazidolead |
|---|
| SMILES | [Cu].[N-]=[N+]=N[Pb]N=[N+]=[N-] |
|---|
| InChI | InChI=1S/Cu.2N3.Pb/c;2*1-3-2;/q;2*-1;+2 |
|---|
| InChIKey | CFTAHYUUXMQYTL-UHFFFAOYSA-N |
|---|
| XLogP | 1.14 |
|---|
| TPSA | 97.52 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 8 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze copper;diazidolead with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;diazidolead?
The IUPAC name of copper;diazidolead (CID 175411369) is copper;diazidolead.
What is the SMILES notation for copper;diazidolead?
The canonical SMILES for copper;diazidolead is [Cu].[N-]=[N+]=N[Pb]N=[N+]=[N-].
What is the InChIKey of copper;diazidolead?
The InChIKey is CFTAHYUUXMQYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/Cu.2N3.Pb/c;2*1-3-2;/q;2*-1;+2.
What are the key properties of copper;diazidolead?
copper;diazidolead has a molecular weight of 354.79 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;diazidolead is sourced from PubChem (CID 175411369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).