C21H46N2O3Si — CID 175411685
1,2,2,3,3-pentaethyl-N-(1-trimethoxysilylpropyl)piperidin-4-amine (PubChem CID 175411685) has the molecular formula C21H46N2O3Si and a molecular weight of 402.70 g/mol. Its IUPAC name is 1,2,2,3,3-pentaethyl-N-(1-trimethoxysilylpropyl)piperidin-4-amine.
| Compound Name | 1,2,2,3,3-pentaethyl-N-(1-trimethoxysilylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 175411685 |
| Molecular Formula | C21H46N2O3Si |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.33 |
| IUPAC Name | 1,2,2,3,3-pentaethyl-N-(1-trimethoxysilylpropyl)piperidin-4-amine |
| SMILES | CCC(NC1CCN(CC)C(CC)(CC)C1(CC)CC)[Si](OC)(OC)OC |
| InChI | InChI=1S/C21H46N2O3Si/c1-10-19(27(24-7,25-8)26-9)22-18-16-17-23(15-6)21(13-4,14-5)20(18,11-2)12-3/h18-19,22H,10-17H2,1-9H3 |
| InChIKey | RMFCRAWPRLDCMG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|